C68H88N8O4+4 — CID 90718604
trimethyl-[3-[4-[10,15,20-tris[4-[3-(trimethylazaniumyl)propoxy]phenyl]-21,22,23,24-tetrahydroporphyrin-5-yl]phenoxy]propyl]azanium (PubChem CID 90718604) has the molecular formula C68H88N8O4+4 and a molecular weight of 1081.50 g/mol. Its IUPAC name is trimethyl-[3-[4-[10,15,20-tris[4-[3-(trimethylazaniumyl)propoxy]phenyl]-21,22,23,24-tetrahydroporphyrin-5-yl]phenoxy]propyl]azanium.
| Compound Name | trimethyl-[3-[4-[10,15,20-tris[4-[3-(trimethylazaniumyl)propoxy]phenyl]-21,22,23,24-tetrahydroporphyrin-5-yl]phenoxy]propyl]azanium |
|---|---|
| PubChem CID | 90718604 |
| Molecular Formula | C68H88N8O4+4 |
| Molecular Weight | 1081.50 g/mol |
| Exact Mass | 1080.69 |
| IUPAC Name | trimethyl-[3-[4-[10,15,20-tris[4-[3-(trimethylazaniumyl)propoxy]phenyl]-21,22,23,24-tetrahydroporphyrin-5-yl]phenoxy]propyl]azanium |
| SMILES | C[N+](C)(C)CCCOc1ccc(C2=c3ccc([nH]3)=C(c3ccc(OCCC[N+](C)(C)C)cc3)c3ccc([nH]3)C(c3ccc(OCCC[N+](C)(C)C)cc3)=c3ccc([nH]3)=C(c3ccc(OCCC[N+](C)(C)C)cc3)c3ccc2[nH]3)cc1 |
| InChI | InChI=1S/C68H88N8O4/c1-73(2,3)41-13-45-77-53-25-17-49(18-26-53)65-57-33-35-59(69-57)66(50-19-27-54(28-20-50)78-46-14-42-74(4,5)6)61-37-39-63(71-61)68(52-23-31-56(32-24-52)80-48-16-44-76(10,11)12)64-40-38-62(72-64)67(60-36-34-58(65)70-60)51-21-29-55(30-22-51)79-47-15-43-75(7,8)9/h17-40,69-72H,13-16,41-48H2,1-12H3/q+4 |
| InChIKey | NQNSVTYJGVSCEP-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 100.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1081.50 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|