C54H32N8O4 — CID 90720247
2-[4-[2-[4-(1,2-dihydro-[1,3]oxazolo[5,4-b]pyridin-2-yl)phenyl]-4,5-bis[4-([1,3]oxazolo[5,4-b]pyridin-2-yl)phenyl]phenyl]phenyl]-[1,3]oxazolo[5,4-b]pyridine (PubChem CID 90720247) has the molecular formula C54H32N8O4 and a molecular weight of 856.90 g/mol. Its IUPAC name is 2-[4-[2-[4-(1,2-dihydro-[1,3]oxazolo[5,4-b]pyridin-2-yl)phenyl]-4,5-bis[4-([1,3]oxazolo[5,4-b]pyridin-2-yl)phenyl]phenyl]phenyl]-[1,3]oxazolo[5,4-b]pyridine.
| Compound Name | 2-[4-[2-[4-(1,2-dihydro-[1,3]oxazolo[5,4-b]pyridin-2-yl)phenyl]-4,5-bis[4-([1,3]oxazolo[5,4-b]pyridin-2-yl)phenyl]phenyl]phenyl]-[1,3]oxazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 90720247 |
| Molecular Formula | C54H32N8O4 |
| Molecular Weight | 856.90 g/mol |
| Exact Mass | 856.25 |
| IUPAC Name | 2-[4-[2-[4-(1,2-dihydro-[1,3]oxazolo[5,4-b]pyridin-2-yl)phenyl]-4,5-bis[4-([1,3]oxazolo[5,4-b]pyridin-2-yl)phenyl]phenyl]phenyl]-[1,3]oxazolo[5,4-b]pyridine |
| SMILES | c1cnc2c(c1)NC(c1ccc(-c3cc(-c4ccc(-c5nc6cccnc6o5)cc4)c(-c4ccc(-c5nc6cccnc6o5)cc4)cc3-c3ccc(-c4nc5cccnc5o4)cc3)cc1)O2 |
| InChI | InChI=1S/C54H32N8O4/c1-5-43-51(55-25-1)63-47(59-43)35-17-9-31(10-18-35)39-29-41(33-13-21-37(22-14-33)49-61-45-7-3-27-57-53(45)65-49)42(34-15-23-38(24-16-34)50-62-46-8-4-28-58-54(46)66-50)30-40(39)32-11-19-36(20-12-32)48-60-44-6-2-26-56-52(44)64-48/h1-30,47,59H |
| InChIKey | FZFZMIOTLIWHLW-UHFFFAOYSA-N |
| XLogP | 12.86 |
| TPSA | 150.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.90 |
| LogP ≤ 5 | 12.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |