C10H14ClNO — CID 90722362
4-(6-chlorocyclohexa-1,4-dien-1-yl)morpholine (PubChem CID 90722362) has the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. Its IUPAC name is 4-(6-chlorocyclohexa-1,4-dien-1-yl)morpholine.
| Compound Name | 4-(6-chlorocyclohexa-1,4-dien-1-yl)morpholine |
|---|---|
| PubChem CID | 90722362 |
| Molecular Formula | C10H14ClNO |
| Molecular Weight | 199.68 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 4-(6-chlorocyclohexa-1,4-dien-1-yl)morpholine |
| SMILES | ClC1C=CCC=C1N1CCOCC1 |
| InChI | InChI=1S/C10H14ClNO/c11-9-3-1-2-4-10(9)12-5-7-13-8-6-12/h1,3-4,9H,2,5-8H2 |
| InChIKey | CBPUFOFZAYNBCU-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.68 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|