C27H18N2O3S2 — CID 90722940
1-(4-phenoxyphenyl)-5-[(5-phenylthiophen-2-yl)methylidene]-6-sulfanylidene-1,3-diazinane-2,4-dione (PubChem CID 90722940) has the molecular formula C27H18N2O3S2 and a molecular weight of 482.59 g/mol. Its IUPAC name is 1-(4-phenoxyphenyl)-5-[(5-phenylthiophen-2-yl)methylidene]-6-sulfanylidene-1,3-diazinane-2,4-dione.
| Compound Name | 1-(4-phenoxyphenyl)-5-[(5-phenylthiophen-2-yl)methylidene]-6-sulfanylidene-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 90722940 |
| Molecular Formula | C27H18N2O3S2 |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | 1-(4-phenoxyphenyl)-5-[(5-phenylthiophen-2-yl)methylidene]-6-sulfanylidene-1,3-diazinane-2,4-dione |
| SMILES | O=C1NC(=O)N(c2ccc(Oc3ccccc3)cc2)C(=S)C1=Cc1ccc(-c2ccccc2)s1 |
| InChI | InChI=1S/C27H18N2O3S2/c30-25-23(17-22-15-16-24(34-22)18-7-3-1-4-8-18)26(33)29(27(31)28-25)19-11-13-21(14-12-19)32-20-9-5-2-6-10-20/h1-17H,(H,28,30,31) |
| InChIKey | BSLARRRXRNLJRE-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|