C24H20N2O7S — CID 90724383
[2-[[4-[(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)methyl]phenyl]carbamoyl]-4-oxochromen-5-yl] 2-methylpropanoate (PubChem CID 90724383) has the molecular formula C24H20N2O7S and a molecular weight of 480.50 g/mol. Its IUPAC name is [2-[[4-[(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)methyl]phenyl]carbamoyl]-4-oxochromen-5-yl] 2-methylpropanoate.
| Compound Name | [2-[[4-[(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)methyl]phenyl]carbamoyl]-4-oxochromen-5-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 90724383 |
| Molecular Formula | C24H20N2O7S |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | [2-[[4-[(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)methyl]phenyl]carbamoyl]-4-oxochromen-5-yl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)Oc1cccc2oc(C(=O)Nc3ccc(Cc4sc(=O)[nH]c4O)cc3)cc(=O)c12 |
| InChI | InChI=1S/C24H20N2O7S/c1-12(2)23(30)33-17-5-3-4-16-20(17)15(27)11-18(32-16)21(28)25-14-8-6-13(7-9-14)10-19-22(29)26-24(31)34-19/h3-9,11-12,29H,10H2,1-2H3,(H,25,28)(H,26,31) |
| InChIKey | SUCZNLAQQYPGJD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 138.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|