C25H29F2NO2 — CID 90724698
1-[(1S,3R)-3-[bis(4-fluorophenyl)methoxy]-2-bicyclo[3.2.1]octanylidene]-N-methoxypropan-1-amine (PubChem CID 90724698) has the molecular formula C25H29F2NO2 and a molecular weight of 413.51 g/mol. Its IUPAC name is 1-[(1S,3R)-3-[bis(4-fluorophenyl)methoxy]-2-bicyclo[3.2.1]octanylidene]-N-methoxypropan-1-amine.
| Compound Name | 1-[(1S,3R)-3-[bis(4-fluorophenyl)methoxy]-2-bicyclo[3.2.1]octanylidene]-N-methoxypropan-1-amine |
|---|---|
| PubChem CID | 90724698 |
| Molecular Formula | C25H29F2NO2 |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 1-[(1S,3R)-3-[bis(4-fluorophenyl)methoxy]-2-bicyclo[3.2.1]octanylidene]-N-methoxypropan-1-amine |
| SMILES | CCC(NOC)=C1[C@H]2CCC(C2)C[C@H]1OC(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H29F2NO2/c1-3-22(28-29-2)24-19-5-4-16(14-19)15-23(24)30-25(17-6-10-20(26)11-7-17)18-8-12-21(27)13-9-18/h6-13,16,19,23,25,28H,3-5,14-15H2,1-2H3/t16?,19-,23+/m0/s1 |
| InChIKey | SDYQAZSGMGFBDR-GAKOPZHISA-N |
| XLogP | 6.07 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|