C23H23N7O4S — CID 90725181
4-[[[1-(3-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]diazenyl]methyl]-N-(2-methylsulfonylethyl)benzamide (PubChem CID 90725181) has the molecular formula C23H23N7O4S and a molecular weight of 493.55 g/mol. Its IUPAC name is 4-[[[1-(3-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]diazenyl]methyl]-N-(2-methylsulfonylethyl)benzamide.
| Compound Name | 4-[[[1-(3-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]diazenyl]methyl]-N-(2-methylsulfonylethyl)benzamide |
|---|---|
| PubChem CID | 90725181 |
| Molecular Formula | C23H23N7O4S |
| Molecular Weight | 493.55 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | 4-[[[1-(3-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]diazenyl]methyl]-N-(2-methylsulfonylethyl)benzamide |
| SMILES | COc1cccc(-n2ncc3c(/N=N/Cc4ccc(C(=O)NCCS(C)(=O)=O)cc4)ncnc32)c1 |
| InChI | InChI=1S/C23H23N7O4S/c1-34-19-5-3-4-18(12-19)30-22-20(14-28-30)21(25-15-26-22)29-27-13-16-6-8-17(9-7-16)23(31)24-10-11-35(2,32)33/h3-9,12,14-15H,10-11,13H2,1-2H3,(H,24,31)/b29-27+ |
| InChIKey | VBQRUEFHEGUGOR-ORIPQNMZSA-N |
| XLogP | 2.88 |
| TPSA | 140.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.55 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|