C20H18N6O3S — CID 90794095
[1-(3-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]-[(4-methylsulfonylphenyl)methyl]diazene (PubChem CID 90794095) has the molecular formula C20H18N6O3S and a molecular weight of 422.47 g/mol. Its IUPAC name is [1-(3-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]-[(4-methylsulfonylphenyl)methyl]diazene.
| Compound Name | [1-(3-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]-[(4-methylsulfonylphenyl)methyl]diazene |
|---|---|
| PubChem CID | 90794095 |
| Molecular Formula | C20H18N6O3S |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | [1-(3-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]-[(4-methylsulfonylphenyl)methyl]diazene |
| SMILES | COc1cccc(-n2ncc3c(/N=N/Cc4ccc(S(C)(=O)=O)cc4)ncnc32)c1 |
| InChI | InChI=1S/C20H18N6O3S/c1-29-16-5-3-4-15(10-16)26-20-18(12-24-26)19(21-13-22-20)25-23-11-14-6-8-17(9-7-14)30(2,27)28/h3-10,12-13H,11H2,1-2H3/b25-23+ |
| InChIKey | WNMDAXFTHKOVIF-WJTDDFOZSA-N |
| XLogP | 3.51 |
| TPSA | 111.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|