C28H29FO5 — CID 90727270
(15S,16S,17S)-15-fluoro-16,17-bis(phenylmethoxy)-2,11,14-trioxatricyclo[11.3.1.04,9]heptadeca-4,6,8-triene (PubChem CID 90727270) has the molecular formula C28H29FO5 and a molecular weight of 464.53 g/mol. Its IUPAC name is (15S,16S,17S)-15-fluoro-16,17-bis(phenylmethoxy)-2,11,14-trioxatricyclo[11.3.1.04,9]heptadeca-4,6,8-triene.
| Compound Name | (15S,16S,17S)-15-fluoro-16,17-bis(phenylmethoxy)-2,11,14-trioxatricyclo[11.3.1.04,9]heptadeca-4,6,8-triene |
|---|---|
| PubChem CID | 90727270 |
| Molecular Formula | C28H29FO5 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | (15S,16S,17S)-15-fluoro-16,17-bis(phenylmethoxy)-2,11,14-trioxatricyclo[11.3.1.04,9]heptadeca-4,6,8-triene |
| SMILES | F[C@@H]1OC2COCc3ccccc3COC([C@H]2OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C28H29FO5/c29-28-27(32-16-21-11-5-2-6-12-21)26-25(31-15-20-9-3-1-4-10-20)24(34-28)19-30-17-22-13-7-8-14-23(22)18-33-26/h1-14,24-28H,15-19H2/t24?,25-,26?,27-,28+/m0/s1 |
| InChIKey | GFYFSDJDJPDMFR-QNKZVRATSA-N |
| XLogP | 4.97 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |