C28H30O6 — CID 68781201
(1S,13R,16R,17R)-16,17-bis(phenylmethoxy)-2,11,14-trioxatricyclo[11.3.1.04,9]heptadeca-4,6,8-trien-15-ol (PubChem CID 68781201) has the molecular formula C28H30O6 and a molecular weight of 462.54 g/mol. Its IUPAC name is (1S,13R,16R,17R)-16,17-bis(phenylmethoxy)-2,11,14-trioxatricyclo[11.3.1.04,9]heptadeca-4,6,8-trien-15-ol.
| Compound Name | (1S,13R,16R,17R)-16,17-bis(phenylmethoxy)-2,11,14-trioxatricyclo[11.3.1.04,9]heptadeca-4,6,8-trien-15-ol |
|---|---|
| PubChem CID | 68781201 |
| Molecular Formula | C28H30O6 |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | (1S,13R,16R,17R)-16,17-bis(phenylmethoxy)-2,11,14-trioxatricyclo[11.3.1.04,9]heptadeca-4,6,8-trien-15-ol |
| SMILES | OC1O[C@@H]2COCc3ccccc3CO[C@@H]([C@@H]2OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C28H30O6/c29-28-27(32-16-21-11-5-2-6-12-21)26-25(31-15-20-9-3-1-4-10-20)24(34-28)19-30-17-22-13-7-8-14-23(22)18-33-26/h1-14,24-29H,15-19H2/t24-,25-,26+,27-,28?/m1/s1 |
| InChIKey | RNACGQJRMFYJGO-GJMNKMQNSA-N |
| XLogP | 3.99 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |