C44H46O5S — CID 177488718
(1S,21R,23S,24R,25R)-23-(2,6-dimethylphenyl)sulfanyl-24,25-bis(phenylmethoxy)-2,19,22-trioxatetracyclo[19.3.1.04,9.012,17]pentacosa-4,6,8,12,14,16-hexaene (PubChem CID 177488718) has the molecular formula C44H46O5S and a molecular weight of 686.91 g/mol. Its IUPAC name is (1S,21R,23S,24R,25R)-23-(2,6-dimethylphenyl)sulfanyl-24,25-bis(phenylmethoxy)-2,19,22-trioxatetracyclo[19.3.1.04,9.012,17]pentacosa-4,6,8,12,14,16-hexaene.
| Compound Name | (1S,21R,23S,24R,25R)-23-(2,6-dimethylphenyl)sulfanyl-24,25-bis(phenylmethoxy)-2,19,22-trioxatetracyclo[19.3.1.04,9.012,17]pentacosa-4,6,8,12,14,16-hexaene |
|---|---|
| PubChem CID | 177488718 |
| Molecular Formula | C44H46O5S |
| Molecular Weight | 686.91 g/mol |
| Exact Mass | 686.31 |
| IUPAC Name | (1S,21R,23S,24R,25R)-23-(2,6-dimethylphenyl)sulfanyl-24,25-bis(phenylmethoxy)-2,19,22-trioxatetracyclo[19.3.1.04,9.012,17]pentacosa-4,6,8,12,14,16-hexaene |
| SMILES | Cc1cccc(C)c1S[C@@H]1O[C@@H]2COCc3ccccc3CCc3ccccc3CO[C@H]([C@H]1OCc1ccccc1)[C@@H]2OCc1ccccc1 |
| InChI | InChI=1S/C44H46O5S/c1-31-14-13-15-32(2)43(31)50-44-42(47-27-34-18-7-4-8-19-34)41-40(46-26-33-16-5-3-6-17-33)39(49-44)30-45-28-37-22-11-9-20-35(37)24-25-36-21-10-12-23-38(36)29-48-41/h3-23,39-42,44H,24-30H2,1-2H3/t39-,40-,41+,42-,44+/m1/s1 |
| InChIKey | QGPXQXOTWQKHJB-ILGQZQAUSA-N |
| XLogP | 9.19 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.91 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |