C38H46N6O6 — CID 90727551
2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[4-[3-methyl-7-(4-nitrophenoxy)-6-oxo-4,7-dihydro-2H-pyrazolo[4,3-c]pyridazin-5-yl]phenyl]butanamide (PubChem CID 90727551) has the molecular formula C38H46N6O6 and a molecular weight of 682.82 g/mol. Its IUPAC name is 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[4-[3-methyl-7-(4-nitrophenoxy)-6-oxo-4,7-dihydro-2H-pyrazolo[4,3-c]pyridazin-5-yl]phenyl]butanamide.
| Compound Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[4-[3-methyl-7-(4-nitrophenoxy)-6-oxo-4,7-dihydro-2H-pyrazolo[4,3-c]pyridazin-5-yl]phenyl]butanamide |
|---|---|
| PubChem CID | 90727551 |
| Molecular Formula | C38H46N6O6 |
| Molecular Weight | 682.82 g/mol |
| Exact Mass | 682.35 |
| IUPAC Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[4-[3-methyl-7-(4-nitrophenoxy)-6-oxo-4,7-dihydro-2H-pyrazolo[4,3-c]pyridazin-5-yl]phenyl]butanamide |
| SMILES | CCC(Oc1ccc(C(C)(C)CC)cc1C(C)(C)CC)C(=O)Nc1ccc(N2Nc3c(n[nH]c3C)C(Oc3ccc([N+](=O)[O-])cc3)C2=O)cc1 |
| InChI | InChI=1S/C38H46N6O6/c1-9-30(50-31-21-12-24(37(5,6)10-2)22-29(31)38(7,8)11-3)35(45)39-25-13-15-26(16-14-25)43-36(46)34(33-32(42-43)23(4)40-41-33)49-28-19-17-27(18-20-28)44(47)48/h12-22,30,34,42H,9-11H2,1-8H3,(H,39,45)(H,40,41) |
| InChIKey | CYGSJEBFUNBWNT-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 151.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.82 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|