C14H18BrFN2O3 — CID 90729550
(5R)-3-fluoro-5-methyl-4-(2-morpholin-4-ylphenyl)-1,3-oxazolidin-3-ium-2-one bromide (PubChem CID 90729550) has the molecular formula C14H18BrFN2O3 and a molecular weight of 361.21 g/mol. Its IUPAC name is (5R)-3-fluoro-5-methyl-4-(2-morpholin-4-ylphenyl)-1,3-oxazolidin-3-ium-2-one bromide.
| Compound Name | (5R)-3-fluoro-5-methyl-4-(2-morpholin-4-ylphenyl)-1,3-oxazolidin-3-ium-2-one bromide |
|---|---|
| PubChem CID | 90729550 |
| Molecular Formula | C14H18BrFN2O3 |
| Molecular Weight | 361.21 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | (5R)-3-fluoro-5-methyl-4-(2-morpholin-4-ylphenyl)-1,3-oxazolidin-3-ium-2-one bromide |
| SMILES | C[C@H]1OC(=O)[NH+](F)C1c1ccccc1N1CCOCC1.[Br-] |
| InChI | InChI=1S/C14H17FN2O3.BrH/c1-10-13(17(15)14(18)20-10)11-4-2-3-5-12(11)16-6-8-19-9-7-16;/h2-5,10,13H,6-9H2,1H3;1H/t10-,13?;/m1./s1 |
| InChIKey | OHPIISOWJAHOTE-HXOUFFEYSA-N |
| XLogP | -2.12 |
| TPSA | 43.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.21 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|