C14H18FN2O6S+ — CID 90913539
(5R)-3-fluoro-5-methyl-4-(2-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-3-ium-3-sulfonic acid (PubChem CID 90913539) has the molecular formula C14H18FN2O6S+ and a molecular weight of 361.37 g/mol. Its IUPAC name is (5R)-3-fluoro-5-methyl-4-(2-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-3-ium-3-sulfonic acid.
| Compound Name | (5R)-3-fluoro-5-methyl-4-(2-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-3-ium-3-sulfonic acid |
|---|---|
| PubChem CID | 90913539 |
| Molecular Formula | C14H18FN2O6S+ |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | (5R)-3-fluoro-5-methyl-4-(2-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-3-ium-3-sulfonic acid |
| SMILES | C[C@H]1OC(=O)[N+](F)(S(=O)(=O)O)C1c1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C14H17FN2O6S/c1-10-13(17(15,14(18)23-10)24(19,20)21)11-4-2-3-5-12(11)16-6-8-22-9-7-16/h2-5,10,13H,6-9H2,1H3/p+1/t10-,13?,17?/m1/s1 |
| InChIKey | REBYLRRRPVWJLC-OPFFKBQKSA-O |
| XLogP | 1.61 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|