C15H15NO5 — CID 67812607
2-(2-hydroxyphenyl)-6-morpholin-4-ylpyran-3,4-dione (PubChem CID 67812607) has the molecular formula C15H15NO5 and a molecular weight of 289.29 g/mol. Its IUPAC name is 2-(2-hydroxyphenyl)-6-morpholin-4-ylpyran-3,4-dione.
| Compound Name | 2-(2-hydroxyphenyl)-6-morpholin-4-ylpyran-3,4-dione |
|---|---|
| PubChem CID | 67812607 |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 2-(2-hydroxyphenyl)-6-morpholin-4-ylpyran-3,4-dione |
| SMILES | O=C1C=C(N2CCOCC2)OC(c2ccccc2O)C1=O |
| InChI | InChI=1S/C15H15NO5/c17-11-4-2-1-3-10(11)15-14(19)12(18)9-13(21-15)16-5-7-20-8-6-16/h1-4,9,15,17H,5-8H2 |
| InChIKey | CEKNMPHZNHSBKM-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|