C24H29NO7 — CID 23596921
8-hydroxy-1-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)-4a,9a-dihydroanthracene-9,10-dione (PubChem CID 23596921) has the molecular formula C24H29NO7 and a molecular weight of 443.50 g/mol. Its IUPAC name is 8-hydroxy-1-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)-4a,9a-dihydroanthracene-9,10-dione.
| Compound Name | 8-hydroxy-1-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)-4a,9a-dihydroanthracene-9,10-dione |
|---|---|
| PubChem CID | 23596921 |
| Molecular Formula | C24H29NO7 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 8-hydroxy-1-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)-4a,9a-dihydroanthracene-9,10-dione |
| SMILES | O=C1c2cccc(O)c2C(=O)C2C(N3CCOCCOCCOCCOCC3)=CC=CC12 |
| InChI | InChI=1S/C24H29NO7/c26-20-6-2-4-18-22(20)24(28)21-17(23(18)27)3-1-5-19(21)25-7-9-29-11-13-31-15-16-32-14-12-30-10-8-25/h1-6,17,21,26H,7-16H2 |
| InChIKey | LMUGETAQGVTJQM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|