C32H44FN3O6S2 — CID 90729959
N-[3-[[(2R)-2-cyclohexyl-2-sulfanylethyl]amino]-3-oxopropyl]-N-[[2-fluoro-4-[2-[[(2S)-2-hydroxypropanoyl]sulfamoyl]phenyl]phenyl]methyl]pentanamide (PubChem CID 90729959) has the molecular formula C32H44FN3O6S2 and a molecular weight of 649.85 g/mol. Its IUPAC name is N-[3-[[(2R)-2-cyclohexyl-2-sulfanylethyl]amino]-3-oxopropyl]-N-[[2-fluoro-4-[2-[[(2S)-2-hydroxypropanoyl]sulfamoyl]phenyl]phenyl]methyl]pentanamide.
| Compound Name | N-[3-[[(2R)-2-cyclohexyl-2-sulfanylethyl]amino]-3-oxopropyl]-N-[[2-fluoro-4-[2-[[(2S)-2-hydroxypropanoyl]sulfamoyl]phenyl]phenyl]methyl]pentanamide |
|---|---|
| PubChem CID | 90729959 |
| Molecular Formula | C32H44FN3O6S2 |
| Molecular Weight | 649.85 g/mol |
| Exact Mass | 649.27 |
| IUPAC Name | N-[3-[[(2R)-2-cyclohexyl-2-sulfanylethyl]amino]-3-oxopropyl]-N-[[2-fluoro-4-[2-[[(2S)-2-hydroxypropanoyl]sulfamoyl]phenyl]phenyl]methyl]pentanamide |
| SMILES | CCCCC(=O)N(CCC(=O)NC[C@H](S)C1CCCCC1)Cc1ccc(-c2ccccc2S(=O)(=O)NC(=O)[C@H](C)O)cc1F |
| InChI | InChI=1S/C32H44FN3O6S2/c1-3-4-14-31(39)36(18-17-30(38)34-20-28(43)23-10-6-5-7-11-23)21-25-16-15-24(19-27(25)33)26-12-8-9-13-29(26)44(41,42)35-32(40)22(2)37/h8-9,12-13,15-16,19,22-23,28,37,43H,3-7,10-11,14,17-18,20-21H2,1-2H3,(H,34,38)(H,35,40)/t22-,28-/m0/s1 |
| InChIKey | INOZVNBOXXJQSC-DWACAAAGSA-N |
| XLogP | 4.58 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.85 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|