C28H30N4O8S — CID 90730315
5-methoxy-N-[1-[4-(1-oxidopyridin-1-ium-2-yl)sulfonyl-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-1-carbonyl]cyclohexyl]-1-benzofuran-2-carboxamide (PubChem CID 90730315) has the molecular formula C28H30N4O8S and a molecular weight of 582.64 g/mol. Its IUPAC name is 5-methoxy-N-[1-[4-(1-oxidopyridin-1-ium-2-yl)sulfonyl-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-1-carbonyl]cyclohexyl]-1-benzofuran-2-carboxamide.
| Compound Name | 5-methoxy-N-[1-[4-(1-oxidopyridin-1-ium-2-yl)sulfonyl-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-1-carbonyl]cyclohexyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 90730315 |
| Molecular Formula | C28H30N4O8S |
| Molecular Weight | 582.64 g/mol |
| Exact Mass | 582.18 |
| IUPAC Name | 5-methoxy-N-[1-[4-(1-oxidopyridin-1-ium-2-yl)sulfonyl-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-1-carbonyl]cyclohexyl]-1-benzofuran-2-carboxamide |
| SMILES | COc1ccc2oc(C(=O)NC3(C(=O)N4CCC5C4C(=O)CN5S(=O)(=O)c4cccc[n+]4[O-])CCCCC3)cc2c1 |
| InChI | InChI=1S/C28H30N4O8S/c1-39-19-8-9-22-18(15-19)16-23(40-22)26(34)29-28(11-4-2-5-12-28)27(35)30-14-10-20-25(30)21(33)17-32(20)41(37,38)24-7-3-6-13-31(24)36/h3,6-9,13,15-16,20,25H,2,4-5,10-12,14,17H2,1H3,(H,29,34) |
| InChIKey | KHKIHFWVCOBKCI-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 153.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.64 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|