C25H30N4O6S2 — CID 91495182
N-[3-cyclohexyl-1-[4-(1-oxidopyridin-1-ium-2-yl)sulfonyl-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-1-oxopropan-2-yl]thiophene-3-carboxamide (PubChem CID 91495182) has the molecular formula C25H30N4O6S2 and a molecular weight of 546.67 g/mol. Its IUPAC name is N-[3-cyclohexyl-1-[4-(1-oxidopyridin-1-ium-2-yl)sulfonyl-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-1-oxopropan-2-yl]thiophene-3-carboxamide.
| Compound Name | N-[3-cyclohexyl-1-[4-(1-oxidopyridin-1-ium-2-yl)sulfonyl-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-1-oxopropan-2-yl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 91495182 |
| Molecular Formula | C25H30N4O6S2 |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.16 |
| IUPAC Name | N-[3-cyclohexyl-1-[4-(1-oxidopyridin-1-ium-2-yl)sulfonyl-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-1-oxopropan-2-yl]thiophene-3-carboxamide |
| SMILES | O=C(NC(CC1CCCCC1)C(=O)N1CCC2C1C(=O)CN2S(=O)(=O)c1cccc[n+]1[O-])c1ccsc1 |
| InChI | InChI=1S/C25H30N4O6S2/c30-21-15-29(37(34,35)22-8-4-5-11-28(22)33)20-9-12-27(23(20)21)25(32)19(14-17-6-2-1-3-7-17)26-24(31)18-10-13-36-16-18/h4-5,8,10-11,13,16-17,19-20,23H,1-3,6-7,9,12,14-15H2,(H,26,31) |
| InChIKey | OUGNFTRTVWITRG-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|