C30H28F3N3O9 — CID 90730580
(4aS,5aR,12aS)-10,12a-dihydroxy-1,3,11,12-tetraoxo-7-propan-2-yl-9-[[4-(trifluoromethoxy)phenyl]carbamoylamino]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 90730580) has the molecular formula C30H28F3N3O9 and a molecular weight of 631.56 g/mol. Its IUPAC name is (4aS,5aR,12aS)-10,12a-dihydroxy-1,3,11,12-tetraoxo-7-propan-2-yl-9-[[4-(trifluoromethoxy)phenyl]carbamoylamino]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aS)-10,12a-dihydroxy-1,3,11,12-tetraoxo-7-propan-2-yl-9-[[4-(trifluoromethoxy)phenyl]carbamoylamino]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90730580 |
| Molecular Formula | C30H28F3N3O9 |
| Molecular Weight | 631.56 g/mol |
| Exact Mass | 631.18 |
| IUPAC Name | (4aS,5aR,12aS)-10,12a-dihydroxy-1,3,11,12-tetraoxo-7-propan-2-yl-9-[[4-(trifluoromethoxy)phenyl]carbamoylamino]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CC(C)c1cc(NC(=O)Nc2ccc(OC(F)(F)F)cc2)c(O)c2c1C[C@H]1C[C@H]3CC(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C30H28F3N3O9/c1-11(2)16-10-18(36-28(43)35-14-3-5-15(6-4-14)45-30(31,32)33)23(38)21-17(16)8-12-7-13-9-19(37)22(27(34)42)26(41)29(13,44)25(40)20(12)24(21)39/h3-6,10-13,20,22,38,44H,7-9H2,1-2H3,(H2,34,42)(H2,35,36,43)/t12-,13+,20?,22?,29+/m1/s1 |
| InChIKey | RORLSWSIBZUMFL-SESHWUEUSA-N |
| XLogP | 2.99 |
| TPSA | 202.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.56 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|