C33H25F3N2O9 — CID 58627504
(4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-[3-[[4-(trifluoromethoxy)phenyl]carbamoyl]phenyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 58627504) has the molecular formula C33H25F3N2O9 and a molecular weight of 650.56 g/mol. Its IUPAC name is (4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-[3-[[4-(trifluoromethoxy)phenyl]carbamoyl]phenyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-[3-[[4-(trifluoromethoxy)phenyl]carbamoyl]phenyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 58627504 |
| Molecular Formula | C33H25F3N2O9 |
| Molecular Weight | 650.56 g/mol |
| Exact Mass | 650.15 |
| IUPAC Name | (4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-[3-[[4-(trifluoromethoxy)phenyl]carbamoyl]phenyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(-c5cccc(C(=O)Nc6ccc(OC(F)(F)F)cc6)c5)c4C[C@H]3C[C@H]2CC1=O |
| InChI | InChI=1S/C33H25F3N2O9/c34-33(35,36)47-19-6-4-18(5-7-19)38-31(45)15-3-1-2-14(10-15)20-8-9-22(39)25-21(20)12-16-11-17-13-23(40)26(30(37)44)29(43)32(17,46)28(42)24(16)27(25)41/h1-10,16-17,39,41,43,46H,11-13H2,(H2,37,44)(H,38,45)/t16-,17+,32+/m1/s1 |
| InChIKey | YNBUKQFYKCDPCG-LUFHRXKISA-N |
| XLogP | 4.24 |
| TPSA | 196.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.56 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|