C13H13BrF3NO2 — CID 90731353
1-(4-bromo-3-methylphenyl)-4,4,4-trifluoro-3-(methoxymethylimino)butan-1-one (PubChem CID 90731353) has the molecular formula C13H13BrF3NO2 and a molecular weight of 352.15 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)-4,4,4-trifluoro-3-(methoxymethylimino)butan-1-one.
| Compound Name | 1-(4-bromo-3-methylphenyl)-4,4,4-trifluoro-3-(methoxymethylimino)butan-1-one |
|---|---|
| PubChem CID | 90731353 |
| Molecular Formula | C13H13BrF3NO2 |
| Molecular Weight | 352.15 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)-4,4,4-trifluoro-3-(methoxymethylimino)butan-1-one |
| SMILES | COCN=C(CC(=O)c1ccc(Br)c(C)c1)C(F)(F)F |
| InChI | InChI=1S/C13H13BrF3NO2/c1-8-5-9(3-4-10(8)14)11(19)6-12(13(15,16)17)18-7-20-2/h3-5H,6-7H2,1-2H3 |
| InChIKey | MJPQDSBMMBHQGF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.15 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|