C11H23NO4 — CID 90732491
[1-(2-hydroxyethoxy)-2-methylpropan-2-yl] N-tert-butylcarbamate (PubChem CID 90732491) has the molecular formula C11H23NO4 and a molecular weight of 233.31 g/mol. Its IUPAC name is [1-(2-hydroxyethoxy)-2-methylpropan-2-yl] N-tert-butylcarbamate.
| Compound Name | [1-(2-hydroxyethoxy)-2-methylpropan-2-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 90732491 |
| Molecular Formula | C11H23NO4 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | [1-(2-hydroxyethoxy)-2-methylpropan-2-yl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OC(C)(C)COCCO |
| InChI | InChI=1S/C11H23NO4/c1-10(2,3)12-9(14)16-11(4,5)8-15-7-6-13/h13H,6-8H2,1-5H3,(H,12,14) |
| InChIKey | SJXCONRHGSTIMH-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|