C11H23NO5 — CID 90811651
2-(1-hydroxy-3-methoxypropan-2-yl)oxyethyl N-tert-butylcarbamate (PubChem CID 90811651) has the molecular formula C11H23NO5 and a molecular weight of 249.31 g/mol. Its IUPAC name is 2-(1-hydroxy-3-methoxypropan-2-yl)oxyethyl N-tert-butylcarbamate.
| Compound Name | 2-(1-hydroxy-3-methoxypropan-2-yl)oxyethyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 90811651 |
| Molecular Formula | C11H23NO5 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | 2-(1-hydroxy-3-methoxypropan-2-yl)oxyethyl N-tert-butylcarbamate |
| SMILES | COCC(CO)OCCOC(=O)NC(C)(C)C |
| InChI | InChI=1S/C11H23NO5/c1-11(2,3)12-10(14)17-6-5-16-9(7-13)8-15-4/h9,13H,5-8H2,1-4H3,(H,12,14) |
| InChIKey | UQZZICAMCLYIBW-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|