C26H25N3O4 — CID 90732886
N-(2,4-dimethoxyphenyl)-4-oxo-3-phenyl-5-(pyridin-2-ylmethylidene)piperidine-1-carboxamide (PubChem CID 90732886) has the molecular formula C26H25N3O4 and a molecular weight of 443.50 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-4-oxo-3-phenyl-5-(pyridin-2-ylmethylidene)piperidine-1-carboxamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-4-oxo-3-phenyl-5-(pyridin-2-ylmethylidene)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 90732886 |
| Molecular Formula | C26H25N3O4 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-4-oxo-3-phenyl-5-(pyridin-2-ylmethylidene)piperidine-1-carboxamide |
| SMILES | COc1ccc(NC(=O)N2CC(=Cc3ccccn3)C(=O)C(c3ccccc3)C2)c(OC)c1 |
| InChI | InChI=1S/C26H25N3O4/c1-32-21-11-12-23(24(15-21)33-2)28-26(31)29-16-19(14-20-10-6-7-13-27-20)25(30)22(17-29)18-8-4-3-5-9-18/h3-15,22H,16-17H2,1-2H3,(H,28,31) |
| InChIKey | JOTHWQWTJFJZQS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|