C19H14Cl2O2S — CID 90733017
[5-(2,4-dichlorophenyl)-2-ethoxyphenyl]-thiophen-2-ylmethanone (PubChem CID 90733017) has the molecular formula C19H14Cl2O2S and a molecular weight of 377.29 g/mol. Its IUPAC name is [5-(2,4-dichlorophenyl)-2-ethoxyphenyl]-thiophen-2-ylmethanone.
| Compound Name | [5-(2,4-dichlorophenyl)-2-ethoxyphenyl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 90733017 |
| Molecular Formula | C19H14Cl2O2S |
| Molecular Weight | 377.29 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | [5-(2,4-dichlorophenyl)-2-ethoxyphenyl]-thiophen-2-ylmethanone |
| SMILES | CCOc1ccc(-c2ccc(Cl)cc2Cl)cc1C(=O)c1cccs1 |
| InChI | InChI=1S/C19H14Cl2O2S/c1-2-23-17-8-5-12(14-7-6-13(20)11-16(14)21)10-15(17)19(22)18-4-3-9-24-18/h3-11H,2H2,1H3 |
| InChIKey | GHVGIFALUYKZSO-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.29 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |