C8H11N3 — CID 90733052
5-(2,5-dihydro-1H-pyrrol-2-yl)-1,2-dihydropyrazine (PubChem CID 90733052) has the molecular formula C8H11N3 and a molecular weight of 149.20 g/mol. Its IUPAC name is 5-(2,5-dihydro-1H-pyrrol-2-yl)-1,2-dihydropyrazine.
| Compound Name | 5-(2,5-dihydro-1H-pyrrol-2-yl)-1,2-dihydropyrazine |
|---|---|
| PubChem CID | 90733052 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 5-(2,5-dihydro-1H-pyrrol-2-yl)-1,2-dihydropyrazine |
| SMILES | C1=CC(C2=CNCC=N2)NC1 |
| InChI | InChI=1S/C8H11N3/c1-2-7(10-3-1)8-6-9-4-5-11-8/h1-2,5-7,9-10H,3-4H2 |
| InChIKey | GWHQVFNNEMDBQS-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|