C11H14N2 — CID 144519148
N-(4H-azepin-2-ylmethyl)buta-1,3-dien-2-amine (PubChem CID 144519148) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is N-(4H-azepin-2-ylmethyl)buta-1,3-dien-2-amine.
| Compound Name | N-(4H-azepin-2-ylmethyl)buta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 144519148 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | N-(4H-azepin-2-ylmethyl)buta-1,3-dien-2-amine |
| SMILES | C=CC(=C)NCC1=CCC=CC=N1 |
| InChI | InChI=1S/C11H14N2/c1-3-10(2)13-9-11-7-5-4-6-8-12-11/h3-4,6-8,13H,1-2,5,9H2 |
| InChIKey | DZXMPUHEIHDEJO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|