C10H15N3 — CID 142928492
N'-[7-(methylideneamino)cyclohepta-1,4,6-trien-1-yl]ethane-1,2-diamine (PubChem CID 142928492) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is N'-[7-(methylideneamino)cyclohepta-1,4,6-trien-1-yl]ethane-1,2-diamine.
| Compound Name | N'-[7-(methylideneamino)cyclohepta-1,4,6-trien-1-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 142928492 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | N'-[7-(methylideneamino)cyclohepta-1,4,6-trien-1-yl]ethane-1,2-diamine |
| SMILES | C=NC1=CC=CCC=C1NCCN |
| InChI | InChI=1S/C10H15N3/c1-12-9-5-3-2-4-6-10(9)13-8-7-11/h2-3,5-6,13H,1,4,7-8,11H2 |
| InChIKey | MAGDKRSPRGHDBL-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|