C9H11N2+ — CID 123335311
1-methylidene-5,6-dihydro-4H-pyrrolo[3,2-b]azepin-1-ium (PubChem CID 123335311) has the molecular formula C9H11N2+ and a molecular weight of 147.20 g/mol. Its IUPAC name is 1-methylidene-5,6-dihydro-4H-pyrrolo[3,2-b]azepin-1-ium.
| Compound Name | 1-methylidene-5,6-dihydro-4H-pyrrolo[3,2-b]azepin-1-ium |
|---|---|
| PubChem CID | 123335311 |
| Molecular Formula | C9H11N2+ |
| Molecular Weight | 147.20 g/mol |
| Exact Mass | 147.09 |
| IUPAC Name | 1-methylidene-5,6-dihydro-4H-pyrrolo[3,2-b]azepin-1-ium |
| SMILES | C=[N+]1C=CC2=C1C=CCCN2 |
| InChI | InChI=1S/C9H11N2/c1-11-7-5-8-9(11)4-2-3-6-10-8/h2,4-5,7,10H,1,3,6H2/q+1 |
| InChIKey | ZMOMEUVDGIEUHN-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.20 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|