C12H18NO2S2+ — CID 90734453
N-ethyl-2-ethylidene-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-1-ium-4-amine (PubChem CID 90734453) has the molecular formula C12H18NO2S2+ and a molecular weight of 272.41 g/mol. Its IUPAC name is N-ethyl-2-ethylidene-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-1-ium-4-amine.
| Compound Name | N-ethyl-2-ethylidene-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-1-ium-4-amine |
|---|---|
| PubChem CID | 90734453 |
| Molecular Formula | C12H18NO2S2+ |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | N-ethyl-2-ethylidene-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-1-ium-4-amine |
| SMILES | CC=C1C=C2C(=[S+]1)S(=O)(=O)C(C)CC2NCC |
| InChI | InChI=1S/C12H18NO2S2/c1-4-9-7-10-11(13-5-2)6-8(3)17(14,15)12(10)16-9/h4,7-8,11,13H,5-6H2,1-3H3/q+1 |
| InChIKey | UNFIQICZBCBCAE-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|