C15H27NO2S — CID 104518817
N-[cyclohexen-1-yl-(1,1-dioxothian-2-yl)methyl]propan-1-amine (PubChem CID 104518817) has the molecular formula C15H27NO2S and a molecular weight of 285.45 g/mol. Its IUPAC name is N-[cyclohexen-1-yl-(1,1-dioxothian-2-yl)methyl]propan-1-amine.
| Compound Name | N-[cyclohexen-1-yl-(1,1-dioxothian-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 104518817 |
| Molecular Formula | C15H27NO2S |
| Molecular Weight | 285.45 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | N-[cyclohexen-1-yl-(1,1-dioxothian-2-yl)methyl]propan-1-amine |
| SMILES | CCCNC(C1=CCCCC1)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C15H27NO2S/c1-2-11-16-15(13-8-4-3-5-9-13)14-10-6-7-12-19(14,17)18/h8,14-16H,2-7,9-12H2,1H3 |
| InChIKey | FRISCIWTYCPWQF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|