C14H33N3O2 — CID 90736722
4,6-dimethoxy-3-methylundecane-3,5,9-triamine (PubChem CID 90736722) has the molecular formula C14H33N3O2 and a molecular weight of 275.44 g/mol. Its IUPAC name is 4,6-dimethoxy-3-methylundecane-3,5,9-triamine.
| Compound Name | 4,6-dimethoxy-3-methylundecane-3,5,9-triamine |
|---|---|
| PubChem CID | 90736722 |
| Molecular Formula | C14H33N3O2 |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.26 |
| IUPAC Name | 4,6-dimethoxy-3-methylundecane-3,5,9-triamine |
| SMILES | CCC(N)CCC(OC)C(N)C(OC)C(C)(N)CC |
| InChI | InChI=1S/C14H33N3O2/c1-6-10(15)8-9-11(18-4)12(16)13(19-5)14(3,17)7-2/h10-13H,6-9,15-17H2,1-5H3 |
| InChIKey | HXUCDMJUQONJCP-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 96.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |