C6H15NO6P2S2 — CID 90737753
[amino-(cyclohexyldisulfanyl)oxyphosphoryl] dihydrogen phosphate (PubChem CID 90737753) has the molecular formula C6H15NO6P2S2 and a molecular weight of 323.27 g/mol. Its IUPAC name is [amino-(cyclohexyldisulfanyl)oxyphosphoryl] dihydrogen phosphate.
| Compound Name | [amino-(cyclohexyldisulfanyl)oxyphosphoryl] dihydrogen phosphate |
|---|---|
| PubChem CID | 90737753 |
| Molecular Formula | C6H15NO6P2S2 |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 322.98 |
| IUPAC Name | [amino-(cyclohexyldisulfanyl)oxyphosphoryl] dihydrogen phosphate |
| SMILES | NP(=O)(OSSC1CCCCC1)OP(=O)(O)O |
| InChI | InChI=1S/C6H15NO6P2S2/c7-14(8,12-15(9,10)11)13-17-16-6-4-2-1-3-5-6/h6H,1-5H2,(H2,7,8)(H2,9,10,11) |
| InChIKey | QBXWLMQBDYWJDL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|