C20H22N2O3S2 — CID 9073784
(E)-3-phenylsulfanyl-N-(4-piperidin-1-ylsulfonylphenyl)prop-2-enamide (PubChem CID 9073784) has the molecular formula C20H22N2O3S2 and a molecular weight of 402.54 g/mol. Its IUPAC name is (E)-3-phenylsulfanyl-N-(4-piperidin-1-ylsulfonylphenyl)prop-2-enamide.
| Compound Name | (E)-3-phenylsulfanyl-N-(4-piperidin-1-ylsulfonylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 9073784 |
| Molecular Formula | C20H22N2O3S2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | (E)-3-phenylsulfanyl-N-(4-piperidin-1-ylsulfonylphenyl)prop-2-enamide |
| SMILES | O=C(/C=C/Sc1ccccc1)Nc1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C20H22N2O3S2/c23-20(13-16-26-18-7-3-1-4-8-18)21-17-9-11-19(12-10-17)27(24,25)22-14-5-2-6-15-22/h1,3-4,7-13,16H,2,5-6,14-15H2,(H,21,23)/b16-13+ |
| InChIKey | OQGMLLDFKAJPEL-DTQAZKPQSA-N |
| XLogP | 4.11 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|