C22H29N2O+ — CID 9073835
diethyl-[[2-[[[(E)-3-(2-methylphenyl)prop-2-enoyl]amino]methyl]phenyl]methyl]azanium (PubChem CID 9073835) has the molecular formula C22H29N2O+ and a molecular weight of 337.49 g/mol. Its IUPAC name is diethyl-[[2-[[[(E)-3-(2-methylphenyl)prop-2-enoyl]amino]methyl]phenyl]methyl]azanium.
| Compound Name | diethyl-[[2-[[[(E)-3-(2-methylphenyl)prop-2-enoyl]amino]methyl]phenyl]methyl]azanium |
|---|---|
| PubChem CID | 9073835 |
| Molecular Formula | C22H29N2O+ |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | diethyl-[[2-[[[(E)-3-(2-methylphenyl)prop-2-enoyl]amino]methyl]phenyl]methyl]azanium |
| SMILES | CC[NH+](CC)Cc1ccccc1CNC(=O)/C=C/c1ccccc1C |
| InChI | InChI=1S/C22H28N2O/c1-4-24(5-2)17-21-13-9-8-12-20(21)16-23-22(25)15-14-19-11-7-6-10-18(19)3/h6-15H,4-5,16-17H2,1-3H3,(H,23,25)/p+1/b15-14+ |
| InChIKey | XEEHCPAXWJRNBT-CCEZHUSRSA-O |
| XLogP | 2.75 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|