C23H30N3O2+ — CID 9073476
[2-[[[(Z)-2-acetamido-3-phenylprop-2-enoyl]amino]methyl]phenyl]methyl-diethylazanium (PubChem CID 9073476) has the molecular formula C23H30N3O2+ and a molecular weight of 380.51 g/mol. Its IUPAC name is [2-[[[(Z)-2-acetamido-3-phenylprop-2-enoyl]amino]methyl]phenyl]methyl-diethylazanium.
| Compound Name | [2-[[[(Z)-2-acetamido-3-phenylprop-2-enoyl]amino]methyl]phenyl]methyl-diethylazanium |
|---|---|
| PubChem CID | 9073476 |
| Molecular Formula | C23H30N3O2+ |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | [2-[[[(Z)-2-acetamido-3-phenylprop-2-enoyl]amino]methyl]phenyl]methyl-diethylazanium |
| SMILES | CC[NH+](CC)Cc1ccccc1CNC(=O)/C(=C/c1ccccc1)NC(C)=O |
| InChI | InChI=1S/C23H29N3O2/c1-4-26(5-2)17-21-14-10-9-13-20(21)16-24-23(28)22(25-18(3)27)15-19-11-7-6-8-12-19/h6-15H,4-5,16-17H2,1-3H3,(H,24,28)(H,25,27)/p+1/b22-15- |
| InChIKey | CQOGSRYNDWCVNO-JCMHNJIXSA-O |
| XLogP | 1.90 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|