About 5-acetamidothiophene-2,4-dicarboxylic acid
5-acetamidothiophene-2,4-dicarboxylic acid (PubChem CID 90738459) has the molecular formula C8H7NO5S
and a molecular weight of 229.21 g/mol. Its IUPAC name is 5-acetamidothiophene-2,4-dicarboxylic acid.
Molecular Properties
| Compound Name | 5-acetamidothiophene-2,4-dicarboxylic acid |
| PubChem CID | 90738459 |
| Molecular Formula | C8H7NO5S |
| Molecular Weight | 229.21 g/mol |
| Exact Mass | 229.00 |
| IUPAC Name | 5-acetamidothiophene-2,4-dicarboxylic acid |
| SMILES | CC(=O)Nc1sc(C(=O)O)cc1C(=O)O |
| InChI | InChI=1S/C8H7NO5S/c1-3(10)9-6-4(7(11)12)2-5(15-6)8(13)14/h2H,1H3,(H,9,10)(H,11,12)(H,13,14) |
| InChIKey | ANFYNXGAWIBDAL-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.21 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-acetamidothiophene-2,4-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-acetamidothiophene-2,4-dicarboxylic acid?
The IUPAC name of 5-acetamidothiophene-2,4-dicarboxylic acid (CID 90738459) is 5-acetamidothiophene-2,4-dicarboxylic acid.
What is the SMILES notation for 5-acetamidothiophene-2,4-dicarboxylic acid?
The canonical SMILES for 5-acetamidothiophene-2,4-dicarboxylic acid is CC(=O)Nc1sc(C(=O)O)cc1C(=O)O.
What is the InChIKey of 5-acetamidothiophene-2,4-dicarboxylic acid?
The InChIKey is ANFYNXGAWIBDAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO5S/c1-3(10)9-6-4(7(11)12)2-5(15-6)8(13)14/h2H,1H3,(H,9,10)(H,11,12)(H,13,14).
What are the key properties of 5-acetamidothiophene-2,4-dicarboxylic acid?
5-acetamidothiophene-2,4-dicarboxylic acid has a molecular weight of 229.21 g/mol, XLogP of 1.10, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-acetamidothiophene-2,4-dicarboxylic acid is sourced from PubChem (CID 90738459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).