C8H7NO5S — CID 90738459
5-acetamidothiophene-2,4-dicarboxylic acid (PubChem CID 90738459) has the molecular formula C8H7NO5S and a molecular weight of 229.21 g/mol. Its IUPAC name is 5-acetamidothiophene-2,4-dicarboxylic acid.
| Compound Name | 5-acetamidothiophene-2,4-dicarboxylic acid |
|---|---|
| PubChem CID | 90738459 |
| Molecular Formula | C8H7NO5S |
| Molecular Weight | 229.21 g/mol |
| Exact Mass | 229.00 |
| IUPAC Name | 5-acetamidothiophene-2,4-dicarboxylic acid |
| SMILES | CC(=O)Nc1sc(C(=O)O)cc1C(=O)O |
| InChI | InChI=1S/C8H7NO5S/c1-3(10)9-6-4(7(11)12)2-5(15-6)8(13)14/h2H,1H3,(H,9,10)(H,11,12)(H,13,14) |
| InChIKey | ANFYNXGAWIBDAL-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.21 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |