C27H32NO4+ — CID 90740788
[6-(2-cyclohexylethoxy)-2-ethoxycarbonyl-3-phenylinden-1-ylidene]-hydroxy-methylazanium (PubChem CID 90740788) has the molecular formula C27H32NO4+ and a molecular weight of 434.56 g/mol. Its IUPAC name is [6-(2-cyclohexylethoxy)-2-ethoxycarbonyl-3-phenylinden-1-ylidene]-hydroxy-methylazanium.
| Compound Name | [6-(2-cyclohexylethoxy)-2-ethoxycarbonyl-3-phenylinden-1-ylidene]-hydroxy-methylazanium |
|---|---|
| PubChem CID | 90740788 |
| Molecular Formula | C27H32NO4+ |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | [6-(2-cyclohexylethoxy)-2-ethoxycarbonyl-3-phenylinden-1-ylidene]-hydroxy-methylazanium |
| SMILES | CCOC(=O)C1=C(c2ccccc2)c2ccc(OCCC3CCCCC3)cc2C1=[N+](C)O |
| InChI | InChI=1S/C27H32NO4/c1-3-31-27(29)25-24(20-12-8-5-9-13-20)22-15-14-21(18-23(22)26(25)28(2)30)32-17-16-19-10-6-4-7-11-19/h5,8-9,12-15,18-19,30H,3-4,6-7,10-11,16-17H2,1-2H3/q+1 |
| InChIKey | WLJUFSNWHWCOJG-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 58.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|