C32H36O4 — CID 143123743
ethyl (3E)-5-[2-(1-adamantyl)ethoxy]-3-(1-hydroxyethylidene)-1-phenylindene-2-carboxylate (PubChem CID 143123743) has the molecular formula C32H36O4 and a molecular weight of 484.64 g/mol. Its IUPAC name is ethyl (3E)-5-[2-(1-adamantyl)ethoxy]-3-(1-hydroxyethylidene)-1-phenylindene-2-carboxylate.
| Compound Name | ethyl (3E)-5-[2-(1-adamantyl)ethoxy]-3-(1-hydroxyethylidene)-1-phenylindene-2-carboxylate |
|---|---|
| PubChem CID | 143123743 |
| Molecular Formula | C32H36O4 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | ethyl (3E)-5-[2-(1-adamantyl)ethoxy]-3-(1-hydroxyethylidene)-1-phenylindene-2-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)c2ccc(OCCC34CC5CC(CC(C5)C3)C4)cc2/C1=C(/C)O |
| InChI | InChI=1S/C32H36O4/c1-3-35-31(34)30-28(20(2)33)27-16-25(9-10-26(27)29(30)24-7-5-4-6-8-24)36-12-11-32-17-21-13-22(18-32)15-23(14-21)19-32/h4-10,16,21-23,33H,3,11-15,17-19H2,1-2H3/b28-20+ |
| InChIKey | GXBRWEQFJTXFFR-VFCFBJKWSA-N |
| XLogP | 7.34 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|