C27H34NO4+ — CID 90878292
[2-ethoxycarbonyl-3-pentan-3-yl-6-(3-phenylpropoxy)inden-1-ylidene]-hydroxy-methylazanium (PubChem CID 90878292) has the molecular formula C27H34NO4+ and a molecular weight of 436.57 g/mol. Its IUPAC name is [2-ethoxycarbonyl-3-pentan-3-yl-6-(3-phenylpropoxy)inden-1-ylidene]-hydroxy-methylazanium.
| Compound Name | [2-ethoxycarbonyl-3-pentan-3-yl-6-(3-phenylpropoxy)inden-1-ylidene]-hydroxy-methylazanium |
|---|---|
| PubChem CID | 90878292 |
| Molecular Formula | C27H34NO4+ |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | [2-ethoxycarbonyl-3-pentan-3-yl-6-(3-phenylpropoxy)inden-1-ylidene]-hydroxy-methylazanium |
| SMILES | CCOC(=O)C1=C(C(CC)CC)c2ccc(OCCCc3ccccc3)cc2C1=[N+](C)O |
| InChI | InChI=1S/C27H34NO4/c1-5-20(6-2)24-22-16-15-21(32-17-11-14-19-12-9-8-10-13-19)18-23(22)26(28(4)30)25(24)27(29)31-7-3/h8-10,12-13,15-16,18,20,30H,5-7,11,14,17H2,1-4H3/q+1 |
| InChIKey | UKFZMJPPVTUZOP-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 58.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|