C29H28O7 — CID 142642799
ethyl 4-oxo-8-[[4-(4-phenylbutoxy)phenyl]methylperoxy]chromene-2-carboxylate (PubChem CID 142642799) has the molecular formula C29H28O7 and a molecular weight of 488.54 g/mol. Its IUPAC name is ethyl 4-oxo-8-[[4-(4-phenylbutoxy)phenyl]methylperoxy]chromene-2-carboxylate.
| Compound Name | ethyl 4-oxo-8-[[4-(4-phenylbutoxy)phenyl]methylperoxy]chromene-2-carboxylate |
|---|---|
| PubChem CID | 142642799 |
| Molecular Formula | C29H28O7 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | ethyl 4-oxo-8-[[4-(4-phenylbutoxy)phenyl]methylperoxy]chromene-2-carboxylate |
| SMILES | CCOC(=O)c1cc(=O)c2cccc(OOCc3ccc(OCCCCc4ccccc4)cc3)c2o1 |
| InChI | InChI=1S/C29H28O7/c1-2-32-29(31)27-19-25(30)24-12-8-13-26(28(24)35-27)36-34-20-22-14-16-23(17-15-22)33-18-7-6-11-21-9-4-3-5-10-21/h3-5,8-10,12-17,19H,2,6-7,11,18,20H2,1H3 |
| InChIKey | LHXCCSUCEZHSFQ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|