C26H26Cl2N2O7 — CID 90741579
3-acetyl-7-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-6,9-dicarboxylic acid (PubChem CID 90741579) has the molecular formula C26H26Cl2N2O7 and a molecular weight of 549.41 g/mol. Its IUPAC name is 3-acetyl-7-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-6,9-dicarboxylic acid.
| Compound Name | 3-acetyl-7-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-6,9-dicarboxylic acid |
|---|---|
| PubChem CID | 90741579 |
| Molecular Formula | C26H26Cl2N2O7 |
| Molecular Weight | 549.41 g/mol |
| Exact Mass | 548.11 |
| IUPAC Name | 3-acetyl-7-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-6,9-dicarboxylic acid |
| SMILES | CC(=O)N1CC2CC(c3ccc(OCCOc4c(Cl)cc(C)cc4Cl)cc3)=C(C(=O)O)C(C1)N2C(=O)O |
| InChI | InChI=1S/C26H26Cl2N2O7/c1-14-9-20(27)24(21(28)10-14)37-8-7-36-18-5-3-16(4-6-18)19-11-17-12-29(15(2)31)13-22(23(19)25(32)33)30(17)26(34)35/h3-6,9-10,17,22H,7-8,11-13H2,1-2H3,(H,32,33)(H,34,35) |
| InChIKey | UFZVGYUNTKZOAC-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.41 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|