C30H44F2O — CID 90741661
1-[4-(4-butan-2-ylcyclohexyl)cyclohexyl]-2,3-difluoro-4-oct-1-yn-3-yloxybenzene (PubChem CID 90741661) has the molecular formula C30H44F2O and a molecular weight of 458.68 g/mol. Its IUPAC name is 1-[4-(4-butan-2-ylcyclohexyl)cyclohexyl]-2,3-difluoro-4-oct-1-yn-3-yloxybenzene.
| Compound Name | 1-[4-(4-butan-2-ylcyclohexyl)cyclohexyl]-2,3-difluoro-4-oct-1-yn-3-yloxybenzene |
|---|---|
| PubChem CID | 90741661 |
| Molecular Formula | C30H44F2O |
| Molecular Weight | 458.68 g/mol |
| Exact Mass | 458.34 |
| IUPAC Name | 1-[4-(4-butan-2-ylcyclohexyl)cyclohexyl]-2,3-difluoro-4-oct-1-yn-3-yloxybenzene |
| SMILES | C#CC(CCCCC)Oc1ccc(C2CCC(C3CCC(C(C)CC)CC3)CC2)c(F)c1F |
| InChI | InChI=1S/C30H44F2O/c1-5-8-9-10-26(7-3)33-28-20-19-27(29(31)30(28)32)25-17-15-24(16-18-25)23-13-11-22(12-14-23)21(4)6-2/h3,19-26H,5-6,8-18H2,1-2,4H3 |
| InChIKey | DTNZCWHIUCJWGA-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.68 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|