C28H40F2O — CID 123774503
2,3-difluoro-1-hept-1-yn-3-yloxy-4-[4-(4-propylcyclohexyl)cyclohexyl]benzene (PubChem CID 123774503) has the molecular formula C28H40F2O and a molecular weight of 430.62 g/mol. Its IUPAC name is 2,3-difluoro-1-hept-1-yn-3-yloxy-4-[4-(4-propylcyclohexyl)cyclohexyl]benzene.
| Compound Name | 2,3-difluoro-1-hept-1-yn-3-yloxy-4-[4-(4-propylcyclohexyl)cyclohexyl]benzene |
|---|---|
| PubChem CID | 123774503 |
| Molecular Formula | C28H40F2O |
| Molecular Weight | 430.62 g/mol |
| Exact Mass | 430.30 |
| IUPAC Name | 2,3-difluoro-1-hept-1-yn-3-yloxy-4-[4-(4-propylcyclohexyl)cyclohexyl]benzene |
| SMILES | C#CC(CCCC)Oc1ccc(C2CCC(C3CCC(CCC)CC3)CC2)c(F)c1F |
| InChI | InChI=1S/C28H40F2O/c1-4-7-9-24(6-3)31-26-19-18-25(27(29)28(26)30)23-16-14-22(15-17-23)21-12-10-20(8-5-2)11-13-21/h3,18-24H,4-5,7-17H2,1-2H3 |
| InChIKey | VWICDJONOBTVCA-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.62 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|