C12H21N2O10P — CID 90741875
[5-[(2-formamidoacetyl)amino]-4-hydroperoxy-3-(2-methylcyclopropyl)oxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 90741875) has the molecular formula C12H21N2O10P and a molecular weight of 384.28 g/mol. Its IUPAC name is [5-[(2-formamidoacetyl)amino]-4-hydroperoxy-3-(2-methylcyclopropyl)oxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [5-[(2-formamidoacetyl)amino]-4-hydroperoxy-3-(2-methylcyclopropyl)oxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 90741875 |
| Molecular Formula | C12H21N2O10P |
| Molecular Weight | 384.28 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | [5-[(2-formamidoacetyl)amino]-4-hydroperoxy-3-(2-methylcyclopropyl)oxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | CC1CC1OC1C(COP(=O)(O)O)OC(NC(=O)CNC=O)C1OO |
| InChI | InChI=1S/C12H21N2O10P/c1-6-2-7(6)22-10-8(4-21-25(18,19)20)23-12(11(10)24-17)14-9(16)3-13-5-15/h5-8,10-12,17H,2-4H2,1H3,(H,13,15)(H,14,16)(H2,18,19,20) |
| InChIKey | QDXLZUZYBCSYDA-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 172.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.28 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|