C17H20N2O3 — CID 90742631
2-(2-butyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl)-2-oxoacetic acid (PubChem CID 90742631) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is 2-(2-butyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl)-2-oxoacetic acid.
| Compound Name | 2-(2-butyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl)-2-oxoacetic acid |
|---|---|
| PubChem CID | 90742631 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 2-(2-butyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl)-2-oxoacetic acid |
| SMILES | CCCCN1CCc2c(n(C(=O)C(=O)O)c3ccccc23)C1 |
| InChI | InChI=1S/C17H20N2O3/c1-2-3-9-18-10-8-13-12-6-4-5-7-14(12)19(15(13)11-18)16(20)17(21)22/h4-7H,2-3,8-11H2,1H3,(H,21,22) |
| InChIKey | PIUDQJWGOGWYNG-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|