C22H23N2NaO2 — CID 140518361
sodium 2-[2-(3-phenylpropyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetate (PubChem CID 140518361) has the molecular formula C22H23N2NaO2 and a molecular weight of 370.43 g/mol. Its IUPAC name is sodium 2-[2-(3-phenylpropyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetate.
| Compound Name | sodium 2-[2-(3-phenylpropyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetate |
|---|---|
| PubChem CID | 140518361 |
| Molecular Formula | C22H23N2NaO2 |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | sodium 2-[2-(3-phenylpropyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetate |
| SMILES | O=C([O-])Cn1c2c(c3ccccc31)CN(CCCc1ccccc1)CC2.[Na+] |
| InChI | InChI=1S/C22H24N2O2.Na/c25-22(26)16-24-20-11-5-4-10-18(20)19-15-23(14-12-21(19)24)13-6-9-17-7-2-1-3-8-17;/h1-5,7-8,10-11H,6,9,12-16H2,(H,25,26);/q;+1/p-1 |
| InChIKey | GZJPDRMQUMFPTR-UHFFFAOYSA-M |
| XLogP | -0.61 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|