C18H14N4S — CID 90742822
N-[5-(6-methyl-2-pyridinyl)quinolin-6-yl]-1,3-thiazol-2-amine (PubChem CID 90742822) has the molecular formula C18H14N4S and a molecular weight of 318.41 g/mol. Its IUPAC name is N-[5-(6-methyl-2-pyridinyl)quinolin-6-yl]-1,3-thiazol-2-amine.
| Compound Name | N-[5-(6-methyl-2-pyridinyl)quinolin-6-yl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 90742822 |
| Molecular Formula | C18H14N4S |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | N-[5-(6-methyl-2-pyridinyl)quinolin-6-yl]-1,3-thiazol-2-amine |
| SMILES | Cc1cccc(-c2c(Nc3nccs3)ccc3ncccc23)n1 |
| InChI | InChI=1S/C18H14N4S/c1-12-4-2-6-15(21-12)17-13-5-3-9-19-14(13)7-8-16(17)22-18-20-10-11-23-18/h2-11H,1H3,(H,20,22) |
| InChIKey | KVPHRWWCYBIZJP-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |