C9H7FN2S — CID 82537266
N-(2-fluorophenyl)-1,3-thiazol-2-amine (PubChem CID 82537266) has the molecular formula C9H7FN2S and a molecular weight of 194.23 g/mol. Its IUPAC name is N-(2-fluorophenyl)-1,3-thiazol-2-amine.
| Compound Name | N-(2-fluorophenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 82537266 |
| Molecular Formula | C9H7FN2S |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | N-(2-fluorophenyl)-1,3-thiazol-2-amine |
| SMILES | Fc1ccccc1Nc1nccs1 |
| InChI | InChI=1S/C9H7FN2S/c10-7-3-1-2-4-8(7)12-9-11-5-6-13-9/h1-6H,(H,11,12) |
| InChIKey | MUSNZNIOCCNDNG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |